C13H27ClN4O2 — CID 119565556
N-[1-(aminomethyl)cyclopentyl]-2-(carbamoylamino)hexanamide;hydrochloride (PubChem CID 119565556) has the molecular formula C13H27ClN4O2 and a molecular weight of 306.84 g/mol. Its IUPAC name is N-[1-(aminomethyl)cyclopentyl]-2-(carbamoylamino)hexanamide;hydrochloride.
| Compound Name | N-[1-(aminomethyl)cyclopentyl]-2-(carbamoylamino)hexanamide;hydrochloride |
|---|---|
| PubChem CID | 119565556 |
| Molecular Formula | C13H27ClN4O2 |
| Molecular Weight | 306.84 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | N-[1-(aminomethyl)cyclopentyl]-2-(carbamoylamino)hexanamide;hydrochloride |
| SMILES | CCCCC(NC(N)=O)C(=O)NC1(CN)CCCC1.Cl |
| InChI | InChI=1S/C13H26N4O2.ClH/c1-2-3-6-10(16-12(15)19)11(18)17-13(9-14)7-4-5-8-13;/h10H,2-9,14H2,1H3,(H,17,18)(H3,15,16,19);1H |
| InChIKey | RUDPPLAOUZPRPA-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.84 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |