C15H21BrClN3O2 — CID 119565780
N-[2-[[1-(aminomethyl)cyclopentyl]amino]-2-oxoethyl]-3-bromobenzamide;hydrochloride (PubChem CID 119565780) has the molecular formula C15H21BrClN3O2 and a molecular weight of 390.71 g/mol. Its IUPAC name is N-[2-[[1-(aminomethyl)cyclopentyl]amino]-2-oxoethyl]-3-bromobenzamide;hydrochloride.
| Compound Name | N-[2-[[1-(aminomethyl)cyclopentyl]amino]-2-oxoethyl]-3-bromobenzamide;hydrochloride |
|---|---|
| PubChem CID | 119565780 |
| Molecular Formula | C15H21BrClN3O2 |
| Molecular Weight | 390.71 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | N-[2-[[1-(aminomethyl)cyclopentyl]amino]-2-oxoethyl]-3-bromobenzamide;hydrochloride |
| SMILES | Cl.NCC1(NC(=O)CNC(=O)c2cccc(Br)c2)CCCC1 |
| InChI | InChI=1S/C15H20BrN3O2.ClH/c16-12-5-3-4-11(8-12)14(21)18-9-13(20)19-15(10-17)6-1-2-7-15;/h3-5,8H,1-2,6-7,9-10,17H2,(H,18,21)(H,19,20);1H |
| InChIKey | VBSKJAFARKJXLY-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.71 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |