C17H25BrClN3O2 — CID 119589813
N-[2-[(2-amino-1-cyclohexylethyl)amino]-2-oxoethyl]-3-bromobenzamide;hydrochloride (PubChem CID 119589813) has the molecular formula C17H25BrClN3O2 and a molecular weight of 418.76 g/mol. Its IUPAC name is N-[2-[(2-amino-1-cyclohexylethyl)amino]-2-oxoethyl]-3-bromobenzamide;hydrochloride.
| Compound Name | N-[2-[(2-amino-1-cyclohexylethyl)amino]-2-oxoethyl]-3-bromobenzamide;hydrochloride |
|---|---|
| PubChem CID | 119589813 |
| Molecular Formula | C17H25BrClN3O2 |
| Molecular Weight | 418.76 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | N-[2-[(2-amino-1-cyclohexylethyl)amino]-2-oxoethyl]-3-bromobenzamide;hydrochloride |
| SMILES | Cl.NCC(NC(=O)CNC(=O)c1cccc(Br)c1)C1CCCCC1 |
| InChI | InChI=1S/C17H24BrN3O2.ClH/c18-14-8-4-7-13(9-14)17(23)20-11-16(22)21-15(10-19)12-5-2-1-3-6-12;/h4,7-9,12,15H,1-3,5-6,10-11,19H2,(H,20,23)(H,21,22);1H |
| InChIKey | RDQNSFHNKNELPZ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.76 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |