C33H44FNO6 — CID 11957738
[(2S,3S,4aS,4bS,10aS,10bR,11S,12aS)-10b-fluoro-11-hydroxy-2-(hydroxymethyl)-3,10a,12a-trimethyl-1,8-dioxo-3,4,4a,4b,5,6,11,12-octahydrochrysen-2-yl] N-(1-adamantyl)carbamate (PubChem CID 11957738) has the molecular formula C33H44FNO6 and a molecular weight of 569.71 g/mol. Its IUPAC name is [(2S,3S,4aS,4bS,10aS,10bR,11S,12aS)-10b-fluoro-11-hydroxy-2-(hydroxymethyl)-3,10a,12a-trimethyl-1,8-dioxo-3,4,4a,4b,5,6,11,12-octahydrochrysen-2-yl] N-(1-adamantyl)carbamate.
| Compound Name | [(2S,3S,4aS,4bS,10aS,10bR,11S,12aS)-10b-fluoro-11-hydroxy-2-(hydroxymethyl)-3,10a,12a-trimethyl-1,8-dioxo-3,4,4a,4b,5,6,11,12-octahydrochrysen-2-yl] N-(1-adamantyl)carbamate |
|---|---|
| PubChem CID | 11957738 |
| Molecular Formula | C33H44FNO6 |
| Molecular Weight | 569.71 g/mol |
| Exact Mass | 569.32 |
| IUPAC Name | [(2S,3S,4aS,4bS,10aS,10bR,11S,12aS)-10b-fluoro-11-hydroxy-2-(hydroxymethyl)-3,10a,12a-trimethyl-1,8-dioxo-3,4,4a,4b,5,6,11,12-octahydrochrysen-2-yl] N-(1-adamantyl)carbamate |
| SMILES | C[C@H]1C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@]2(C)C(=O)[C@]1(CO)OC(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C33H44FNO6/c1-18-8-25-24-5-4-22-12-23(37)6-7-30(22,3)33(24,34)26(38)16-29(25,2)27(39)32(18,17-36)41-28(40)35-31-13-19-9-20(14-31)11-21(10-19)15-31/h6-7,12,18-21,24-26,36,38H,4-5,8-11,13-17H2,1-3H3,(H,35,40)/t18-,19?,20?,21?,24-,25-,26-,29-,30-,31?,32+,33-/m0/s1 |
| InChIKey | GLLQHEWVVWFJDI-ZNCAMXLSSA-N |
| XLogP | 4.60 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.71 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |