C28H40FNO6 — CID 11976688
[(2S,3S,10aS,10bR,11S,12aS)-10b-fluoro-11-hydroxy-2-(hydroxymethyl)-3,10a,12a-trimethyl-1,8-dioxo-3,4,4a,4b,5,6,11,12-octahydrochrysen-2-yl] N-pentan-2-ylcarbamate (PubChem CID 11976688) has the molecular formula C28H40FNO6 and a molecular weight of 505.63 g/mol. Its IUPAC name is [(2S,3S,10aS,10bR,11S,12aS)-10b-fluoro-11-hydroxy-2-(hydroxymethyl)-3,10a,12a-trimethyl-1,8-dioxo-3,4,4a,4b,5,6,11,12-octahydrochrysen-2-yl] N-pentan-2-ylcarbamate.
| Compound Name | [(2S,3S,10aS,10bR,11S,12aS)-10b-fluoro-11-hydroxy-2-(hydroxymethyl)-3,10a,12a-trimethyl-1,8-dioxo-3,4,4a,4b,5,6,11,12-octahydrochrysen-2-yl] N-pentan-2-ylcarbamate |
|---|---|
| PubChem CID | 11976688 |
| Molecular Formula | C28H40FNO6 |
| Molecular Weight | 505.63 g/mol |
| Exact Mass | 505.28 |
| IUPAC Name | [(2S,3S,10aS,10bR,11S,12aS)-10b-fluoro-11-hydroxy-2-(hydroxymethyl)-3,10a,12a-trimethyl-1,8-dioxo-3,4,4a,4b,5,6,11,12-octahydrochrysen-2-yl] N-pentan-2-ylcarbamate |
| SMILES | CCCC(C)NC(=O)O[C@@]1(CO)C(=O)[C@@]2(C)C[C@H](O)[C@@]3(F)C(CCC4=CC(=O)C=C[C@@]43C)C2C[C@@H]1C |
| InChI | InChI=1S/C28H40FNO6/c1-6-7-17(3)30-24(35)36-27(15-31)16(2)12-21-20-9-8-18-13-19(32)10-11-26(18,5)28(20,29)22(33)14-25(21,4)23(27)34/h10-11,13,16-17,20-22,31,33H,6-9,12,14-15H2,1-5H3,(H,30,35)/t16-,17?,20?,21?,22-,25-,26-,27+,28-/m0/s1 |
| InChIKey | ZECBEGXXSRBDKZ-AKNHLVDWSA-N |
| XLogP | 3.82 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.63 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |