About methyl 4-nitroheptanoate
methyl 4-nitroheptanoate (PubChem CID 11957850) has the molecular formula C8H15NO4
and a molecular weight of 189.21 g/mol. Its IUPAC name is methyl 4-nitroheptanoate.
Molecular Properties
| Compound Name | methyl 4-nitroheptanoate |
| PubChem CID | 11957850 |
| Molecular Formula | C8H15NO4 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | methyl 4-nitroheptanoate |
| SMILES | CCCC(CCC(=O)OC)[N+](=O)[O-] |
| InChI | InChI=1S/C8H15NO4/c1-3-4-7(9(11)12)5-6-8(10)13-2/h7H,3-6H2,1-2H3 |
| InChIKey | JYKVWEAIMPKWPZ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-nitroheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-nitroheptanoate?
The IUPAC name of methyl 4-nitroheptanoate (CID 11957850) is methyl 4-nitroheptanoate.
What is the SMILES notation for methyl 4-nitroheptanoate?
The canonical SMILES for methyl 4-nitroheptanoate is CCCC(CCC(=O)OC)[N+](=O)[O-].
What is the InChIKey of methyl 4-nitroheptanoate?
The InChIKey is JYKVWEAIMPKWPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO4/c1-3-4-7(9(11)12)5-6-8(10)13-2/h7H,3-6H2,1-2H3.
What are the key properties of methyl 4-nitroheptanoate?
methyl 4-nitroheptanoate has a molecular weight of 189.21 g/mol, XLogP of 1.38, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-nitroheptanoate is sourced from PubChem (CID 11957850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).