C16H14BrN3S — CID 11958752
10-methyl-3-phenyl-2H-[1,3,4]thiadiazino[3,2-a]benzimidazol-10-ium bromide (PubChem CID 11958752) has the molecular formula C16H14BrN3S and a molecular weight of 360.28 g/mol. Its IUPAC name is 10-methyl-3-phenyl-2H-[1,3,4]thiadiazino[3,2-a]benzimidazol-10-ium bromide.
| Compound Name | 10-methyl-3-phenyl-2H-[1,3,4]thiadiazino[3,2-a]benzimidazol-10-ium bromide |
|---|---|
| PubChem CID | 11958752 |
| Molecular Formula | C16H14BrN3S |
| Molecular Weight | 360.28 g/mol |
| Exact Mass | 359.01 |
| IUPAC Name | 10-methyl-3-phenyl-2H-[1,3,4]thiadiazino[3,2-a]benzimidazol-10-ium bromide |
| SMILES | C[n+]1c2n(c3ccccc31)N=C(c1ccccc1)CS2.[Br-] |
| InChI | InChI=1S/C16H14N3S.BrH/c1-18-14-9-5-6-10-15(14)19-16(18)20-11-13(17-19)12-7-3-2-4-8-12;/h2-10H,11H2,1H3;1H/q+1;/p-1 |
| InChIKey | QQFICQRBHVWHNY-UHFFFAOYSA-M |
| XLogP | -0.17 |
| TPSA | 21.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.28 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_thio_656c(1)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|