C5H7NO2 — CID 1196
3,4-dihydro-2H-pyrrole-2-carboxylic acid (PubChem CID 1196) has the molecular formula C5H7NO2 and a molecular weight of 113.12 g/mol. Its IUPAC name is 3,4-dihydro-2H-pyrrole-2-carboxylic acid.
| Compound Name | 3,4-dihydro-2H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 1196 |
| Molecular Formula | C5H7NO2 |
| Molecular Weight | 113.12 g/mol |
| Exact Mass | 113.05 |
| IUPAC Name | 3,4-dihydro-2H-pyrrole-2-carboxylic acid |
| SMILES | O=C(O)C1CCC=N1 |
| InChI | InChI=1S/C5H7NO2/c7-5(8)4-2-1-3-6-4/h3-4H,1-2H2,(H,7,8) |
| InChIKey | DWAKNKKXGALPNW-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.12 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |