C13H25ClN2O3S — CID 119601349
N-[2-(aminomethyl)cyclopentyl]-2-cyclopentylsulfonylacetamide;hydrochloride (PubChem CID 119601349) has the molecular formula C13H25ClN2O3S and a molecular weight of 324.87 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclopentyl]-2-cyclopentylsulfonylacetamide;hydrochloride.
| Compound Name | N-[2-(aminomethyl)cyclopentyl]-2-cyclopentylsulfonylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119601349 |
| Molecular Formula | C13H25ClN2O3S |
| Molecular Weight | 324.87 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | N-[2-(aminomethyl)cyclopentyl]-2-cyclopentylsulfonylacetamide;hydrochloride |
| SMILES | Cl.NCC1CCCC1NC(=O)CS(=O)(=O)C1CCCC1 |
| InChI | InChI=1S/C13H24N2O3S.ClH/c14-8-10-4-3-7-12(10)15-13(16)9-19(17,18)11-5-1-2-6-11;/h10-12H,1-9,14H2,(H,15,16);1H |
| InChIKey | ALBSUNISJXOWLA-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.87 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |