C16H30N4O2S — CID 119607603
5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-(1-amino-2,3-dimethylbutan-2-yl)pentanamide (PubChem CID 119607603) has the molecular formula C16H30N4O2S and a molecular weight of 342.51 g/mol. Its IUPAC name is 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-(1-amino-2,3-dimethylbutan-2-yl)pentanamide.
| Compound Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-(1-amino-2,3-dimethylbutan-2-yl)pentanamide |
|---|---|
| PubChem CID | 119607603 |
| Molecular Formula | C16H30N4O2S |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-(1-amino-2,3-dimethylbutan-2-yl)pentanamide |
| SMILES | CC(C)C(C)(CN)NC(=O)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21 |
| InChI | InChI=1S/C16H30N4O2S/c1-10(2)16(3,9-17)20-13(21)7-5-4-6-12-14-11(8-23-12)18-15(22)19-14/h10-12,14H,4-9,17H2,1-3H3,(H,20,21)(H2,18,19,22)/t11-,12-,14-,16?/m0/s1 |
| InChIKey | KHCTVGJQPBCVQG-PYQRVFGBSA-N |
| XLogP | 1.20 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|