C19H33N3O3S — CID 91471777
5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)-N-(2,4,4-trimethyl-5-oxohexan-2-yl)pentanamide (PubChem CID 91471777) has the molecular formula C19H33N3O3S and a molecular weight of 383.56 g/mol. Its IUPAC name is 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)-N-(2,4,4-trimethyl-5-oxohexan-2-yl)pentanamide.
| Compound Name | 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)-N-(2,4,4-trimethyl-5-oxohexan-2-yl)pentanamide |
|---|---|
| PubChem CID | 91471777 |
| Molecular Formula | C19H33N3O3S |
| Molecular Weight | 383.56 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)-N-(2,4,4-trimethyl-5-oxohexan-2-yl)pentanamide |
| SMILES | CC(=O)C(C)(C)CC(C)(C)NC(=O)CCCCC1SCC2NC(=O)NC21 |
| InChI | InChI=1S/C19H33N3O3S/c1-12(23)18(2,3)11-19(4,5)22-15(24)9-7-6-8-14-16-13(10-26-14)20-17(25)21-16/h13-14,16H,6-11H2,1-5H3,(H,22,24)(H2,20,21,25) |
| InChIKey | FVUJJLFLZHGPKZ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.56 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|