C25H43N5O4S — CID 154952814
N-[1-[[3-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]-3-methylbutyl]amino]-2-methyl-1-oxopropan-2-yl]-2,2-dimethylbut-3-enamide (PubChem CID 154952814) has the molecular formula C25H43N5O4S and a molecular weight of 509.72 g/mol. Its IUPAC name is N-[1-[[3-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]-3-methylbutyl]amino]-2-methyl-1-oxopropan-2-yl]-2,2-dimethylbut-3-enamide.
| Compound Name | N-[1-[[3-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]-3-methylbutyl]amino]-2-methyl-1-oxopropan-2-yl]-2,2-dimethylbut-3-enamide |
|---|---|
| PubChem CID | 154952814 |
| Molecular Formula | C25H43N5O4S |
| Molecular Weight | 509.72 g/mol |
| Exact Mass | 509.30 |
| IUPAC Name | N-[1-[[3-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]-3-methylbutyl]amino]-2-methyl-1-oxopropan-2-yl]-2,2-dimethylbut-3-enamide |
| SMILES | C=CC(C)(C)C(=O)NC(C)(C)C(=O)NCCC(C)(C)NC(=O)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21 |
| InChI | InChI=1S/C25H43N5O4S/c1-8-23(2,3)20(32)30-25(6,7)21(33)26-14-13-24(4,5)29-18(31)12-10-9-11-17-19-16(15-35-17)27-22(34)28-19/h8,16-17,19H,1,9-15H2,2-7H3,(H,26,33)(H,29,31)(H,30,32)(H2,27,28,34)/t16-,17-,19-/m0/s1 |
| InChIKey | YLKPBMPGCAQLBM-LNLFQRSKSA-N |
| XLogP | 2.22 |
| TPSA | 128.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.72 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|