C21H34N4O4S — CID 134501792
N-[3-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]propyl]-2-methyl-2-(2-oxoethyl)pent-4-enamide (PubChem CID 134501792) has the molecular formula C21H34N4O4S and a molecular weight of 438.59 g/mol. Its IUPAC name is N-[3-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]propyl]-2-methyl-2-(2-oxoethyl)pent-4-enamide.
| Compound Name | N-[3-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]propyl]-2-methyl-2-(2-oxoethyl)pent-4-enamide |
|---|---|
| PubChem CID | 134501792 |
| Molecular Formula | C21H34N4O4S |
| Molecular Weight | 438.59 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | N-[3-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]propyl]-2-methyl-2-(2-oxoethyl)pent-4-enamide |
| SMILES | C=CCC(C)(CC=O)C(=O)NCCCNC(=O)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21 |
| InChI | InChI=1S/C21H34N4O4S/c1-3-9-21(2,10-13-26)19(28)23-12-6-11-22-17(27)8-5-4-7-16-18-15(14-30-16)24-20(29)25-18/h3,13,15-16,18H,1,4-12,14H2,2H3,(H,22,27)(H,23,28)(H2,24,25,29)/t15-,16-,18-,21?/m0/s1 |
| InChIKey | QRADRMQCCGIXQI-SOTOXROOSA-N |
| XLogP | 1.51 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.59 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|