C30H42N4O7 — CID 11961053
2-(3-butyl-2,5-dioxoimidazolidin-1-yl)-N-[5-[2-(3-hydroxycyclohexen-1-yl)propanoylamino]-2-methoxyphenyl]-4,4-dimethyl-3-oxopentanamide (PubChem CID 11961053) has the molecular formula C30H42N4O7 and a molecular weight of 570.69 g/mol. Its IUPAC name is 2-(3-butyl-2,5-dioxoimidazolidin-1-yl)-N-[5-[2-(3-hydroxycyclohexen-1-yl)propanoylamino]-2-methoxyphenyl]-4,4-dimethyl-3-oxopentanamide.
| Compound Name | 2-(3-butyl-2,5-dioxoimidazolidin-1-yl)-N-[5-[2-(3-hydroxycyclohexen-1-yl)propanoylamino]-2-methoxyphenyl]-4,4-dimethyl-3-oxopentanamide |
|---|---|
| PubChem CID | 11961053 |
| Molecular Formula | C30H42N4O7 |
| Molecular Weight | 570.69 g/mol |
| Exact Mass | 570.31 |
| IUPAC Name | 2-(3-butyl-2,5-dioxoimidazolidin-1-yl)-N-[5-[2-(3-hydroxycyclohexen-1-yl)propanoylamino]-2-methoxyphenyl]-4,4-dimethyl-3-oxopentanamide |
| SMILES | CCCCN1CC(=O)N(C(C(=O)Nc2cc(NC(=O)C(C)C3=CC(O)CCC3)ccc2OC)C(=O)C(C)(C)C)C1=O |
| InChI | InChI=1S/C30H42N4O7/c1-7-8-14-33-17-24(36)34(29(33)40)25(26(37)30(3,4)5)28(39)32-22-16-20(12-13-23(22)41-6)31-27(38)18(2)19-10-9-11-21(35)15-19/h12-13,15-16,18,21,25,35H,7-11,14,17H2,1-6H3,(H,31,38)(H,32,39) |
| InChIKey | NMLKSWKEEVTTJS-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 145.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.69 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|