C13H18ClN3O3S — CID 119616130
N-(2-amino-1-cyclopropylethyl)-4-methylsulfanyl-3-nitrobenzamide;hydrochloride (PubChem CID 119616130) has the molecular formula C13H18ClN3O3S and a molecular weight of 331.83 g/mol. Its IUPAC name is N-(2-amino-1-cyclopropylethyl)-4-methylsulfanyl-3-nitrobenzamide;hydrochloride.
| Compound Name | N-(2-amino-1-cyclopropylethyl)-4-methylsulfanyl-3-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 119616130 |
| Molecular Formula | C13H18ClN3O3S |
| Molecular Weight | 331.83 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | N-(2-amino-1-cyclopropylethyl)-4-methylsulfanyl-3-nitrobenzamide;hydrochloride |
| SMILES | CSc1ccc(C(=O)NC(CN)C2CC2)cc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C13H17N3O3S.ClH/c1-20-12-5-4-9(6-11(12)16(18)19)13(17)15-10(7-14)8-2-3-8;/h4-6,8,10H,2-3,7,14H2,1H3,(H,15,17);1H |
| InChIKey | KDNDDJVXFHOMSL-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.83 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|