C12H11NO — CID 11961766
(1R,2R,3S,4S)-3-(furan-2-yl)bicyclo[2.2.1]hept-5-ene-2-carbonitrile (PubChem CID 11961766) has the molecular formula C12H11NO and a molecular weight of 185.23 g/mol. Its IUPAC name is (1R,2R,3S,4S)-3-(furan-2-yl)bicyclo[2.2.1]hept-5-ene-2-carbonitrile.
| Compound Name | (1R,2R,3S,4S)-3-(furan-2-yl)bicyclo[2.2.1]hept-5-ene-2-carbonitrile |
|---|---|
| PubChem CID | 11961766 |
| Molecular Formula | C12H11NO |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | (1R,2R,3S,4S)-3-(furan-2-yl)bicyclo[2.2.1]hept-5-ene-2-carbonitrile |
| SMILES | N#C[C@H]1[C@@H](c2ccco2)[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C12H11NO/c13-7-10-8-3-4-9(6-8)12(10)11-2-1-5-14-11/h1-5,8-10,12H,6H2/t8-,9+,10+,12-/m0/s1 |
| InChIKey | GYMZXDANKQEGMK-XNDJQWLSSA-N |
| XLogP | 2.71 |
| TPSA | 36.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|