C11H12OS — CID 14900864
2-[(1R,3S,4S)-2-thiabicyclo[2.2.2]oct-5-en-3-yl]furan (PubChem CID 14900864) has the molecular formula C11H12OS and a molecular weight of 192.28 g/mol. Its IUPAC name is 2-[(1R,3S,4S)-2-thiabicyclo[2.2.2]oct-5-en-3-yl]furan.
| Compound Name | 2-[(1R,3S,4S)-2-thiabicyclo[2.2.2]oct-5-en-3-yl]furan |
|---|---|
| PubChem CID | 14900864 |
| Molecular Formula | C11H12OS |
| Molecular Weight | 192.28 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | 2-[(1R,3S,4S)-2-thiabicyclo[2.2.2]oct-5-en-3-yl]furan |
| SMILES | C1=C[C@H]2CC[C@@H]1[C@@H](c1ccco1)S2 |
| InChI | InChI=1S/C11H12OS/c1-2-10(12-7-1)11-8-3-5-9(13-11)6-4-8/h1-3,5,7-9,11H,4,6H2/t8-,9+,11+/m1/s1 |
| InChIKey | PTOCXUGNIVJBIK-YWVKMMECSA-N |
| XLogP | 3.40 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.28 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|