C19H20N2O5S — CID 119618457
N-(6-amino-1,3-benzodioxol-5-yl)-3-(2,3-dihydro-1H-inden-5-ylsulfonyl)propanamide (PubChem CID 119618457) has the molecular formula C19H20N2O5S and a molecular weight of 388.45 g/mol. Its IUPAC name is N-(6-amino-1,3-benzodioxol-5-yl)-3-(2,3-dihydro-1H-inden-5-ylsulfonyl)propanamide.
| Compound Name | N-(6-amino-1,3-benzodioxol-5-yl)-3-(2,3-dihydro-1H-inden-5-ylsulfonyl)propanamide |
|---|---|
| PubChem CID | 119618457 |
| Molecular Formula | C19H20N2O5S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | N-(6-amino-1,3-benzodioxol-5-yl)-3-(2,3-dihydro-1H-inden-5-ylsulfonyl)propanamide |
| SMILES | Nc1cc2c(cc1NC(=O)CCS(=O)(=O)c1ccc3c(c1)CCC3)OCO2 |
| InChI | InChI=1S/C19H20N2O5S/c20-15-9-17-18(26-11-25-17)10-16(15)21-19(22)6-7-27(23,24)14-5-4-12-2-1-3-13(12)8-14/h4-5,8-10H,1-3,6-7,11,20H2,(H,21,22) |
| InChIKey | CSWARXSIGGCXSE-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|