C26H27NO4S — CID 52723374
3-(2,3-dihydro-1H-inden-5-ylsulfonyl)-N-[2-(2-phenylethoxy)phenyl]propanamide (PubChem CID 52723374) has the molecular formula C26H27NO4S and a molecular weight of 449.57 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-inden-5-ylsulfonyl)-N-[2-(2-phenylethoxy)phenyl]propanamide.
| Compound Name | 3-(2,3-dihydro-1H-inden-5-ylsulfonyl)-N-[2-(2-phenylethoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 52723374 |
| Molecular Formula | C26H27NO4S |
| Molecular Weight | 449.57 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | 3-(2,3-dihydro-1H-inden-5-ylsulfonyl)-N-[2-(2-phenylethoxy)phenyl]propanamide |
| SMILES | O=C(CCS(=O)(=O)c1ccc2c(c1)CCC2)Nc1ccccc1OCCc1ccccc1 |
| InChI | InChI=1S/C26H27NO4S/c28-26(16-18-32(29,30)23-14-13-21-9-6-10-22(21)19-23)27-24-11-4-5-12-25(24)31-17-15-20-7-2-1-3-8-20/h1-5,7-8,11-14,19H,6,9-10,15-18H2,(H,27,28) |
| InChIKey | HLXPUEAPLNWVGG-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.57 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |