C23H22BrNO4S — CID 60531511
2-[(3-bromophenyl)methylsulfonyl]-N-[2-(2-phenylethoxy)phenyl]acetamide (PubChem CID 60531511) has the molecular formula C23H22BrNO4S and a molecular weight of 488.40 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methylsulfonyl]-N-[2-(2-phenylethoxy)phenyl]acetamide.
| Compound Name | 2-[(3-bromophenyl)methylsulfonyl]-N-[2-(2-phenylethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 60531511 |
| Molecular Formula | C23H22BrNO4S |
| Molecular Weight | 488.40 g/mol |
| Exact Mass | 487.05 |
| IUPAC Name | 2-[(3-bromophenyl)methylsulfonyl]-N-[2-(2-phenylethoxy)phenyl]acetamide |
| SMILES | O=C(CS(=O)(=O)Cc1cccc(Br)c1)Nc1ccccc1OCCc1ccccc1 |
| InChI | InChI=1S/C23H22BrNO4S/c24-20-10-6-9-19(15-20)16-30(27,28)17-23(26)25-21-11-4-5-12-22(21)29-14-13-18-7-2-1-3-8-18/h1-12,15H,13-14,16-17H2,(H,25,26) |
| InChIKey | BJPFQJXZZRJNHD-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.40 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |