C22H21BrN2O3S — CID 60573595
N'-benzyl-2-[(3-bromophenyl)methylsulfonyl]-N'-phenylacetohydrazide (PubChem CID 60573595) has the molecular formula C22H21BrN2O3S and a molecular weight of 473.39 g/mol. Its IUPAC name is N'-benzyl-2-[(3-bromophenyl)methylsulfonyl]-N'-phenylacetohydrazide.
| Compound Name | N'-benzyl-2-[(3-bromophenyl)methylsulfonyl]-N'-phenylacetohydrazide |
|---|---|
| PubChem CID | 60573595 |
| Molecular Formula | C22H21BrN2O3S |
| Molecular Weight | 473.39 g/mol |
| Exact Mass | 472.05 |
| IUPAC Name | N'-benzyl-2-[(3-bromophenyl)methylsulfonyl]-N'-phenylacetohydrazide |
| SMILES | O=C(CS(=O)(=O)Cc1cccc(Br)c1)NN(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H21BrN2O3S/c23-20-11-7-10-19(14-20)16-29(27,28)17-22(26)24-25(21-12-5-2-6-13-21)15-18-8-3-1-4-9-18/h1-14H,15-17H2,(H,24,26) |
| InChIKey | XCGANZPPEBCBBD-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.39 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|