C19H21BrN2O4S — CID 52741726
2-[[2-[(3-bromophenyl)methylsulfonyl]acetyl]amino]-N-propan-2-ylbenzamide (PubChem CID 52741726) has the molecular formula C19H21BrN2O4S and a molecular weight of 453.36 g/mol. Its IUPAC name is 2-[[2-[(3-bromophenyl)methylsulfonyl]acetyl]amino]-N-propan-2-ylbenzamide.
| Compound Name | 2-[[2-[(3-bromophenyl)methylsulfonyl]acetyl]amino]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 52741726 |
| Molecular Formula | C19H21BrN2O4S |
| Molecular Weight | 453.36 g/mol |
| Exact Mass | 452.04 |
| IUPAC Name | 2-[[2-[(3-bromophenyl)methylsulfonyl]acetyl]amino]-N-propan-2-ylbenzamide |
| SMILES | CC(C)NC(=O)c1ccccc1NC(=O)CS(=O)(=O)Cc1cccc(Br)c1 |
| InChI | InChI=1S/C19H21BrN2O4S/c1-13(2)21-19(24)16-8-3-4-9-17(16)22-18(23)12-27(25,26)11-14-6-5-7-15(20)10-14/h3-10,13H,11-12H2,1-2H3,(H,21,24)(H,22,23) |
| InChIKey | ZRRNHGBAGVLKQO-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |