C19H21ClN2O3 — CID 119618623
N-(6-amino-1,3-benzodioxol-5-yl)-2-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide;hydrochloride (PubChem CID 119618623) has the molecular formula C19H21ClN2O3 and a molecular weight of 360.84 g/mol. Its IUPAC name is N-(6-amino-1,3-benzodioxol-5-yl)-2-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide;hydrochloride.
| Compound Name | N-(6-amino-1,3-benzodioxol-5-yl)-2-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119618623 |
| Molecular Formula | C19H21ClN2O3 |
| Molecular Weight | 360.84 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | N-(6-amino-1,3-benzodioxol-5-yl)-2-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide;hydrochloride |
| SMILES | Cl.Nc1cc2c(cc1NC(=O)CC1CCCc3ccccc31)OCO2 |
| InChI | InChI=1S/C19H20N2O3.ClH/c20-15-9-17-18(24-11-23-17)10-16(15)21-19(22)8-13-6-3-5-12-4-1-2-7-14(12)13;/h1-2,4,7,9-10,13H,3,5-6,8,11,20H2,(H,21,22);1H |
| InChIKey | DFOHPONYLGRBEU-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.84 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|