C20H20F3NO2 — CID 97260269
2-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]-N-[2-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]phenyl]acetamide (PubChem CID 97260269) has the molecular formula C20H20F3NO2 and a molecular weight of 363.38 g/mol. Its IUPAC name is 2-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]-N-[2-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]phenyl]acetamide.
| Compound Name | 2-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]-N-[2-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 97260269 |
| Molecular Formula | C20H20F3NO2 |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 2-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]-N-[2-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]phenyl]acetamide |
| SMILES | O=C(C[C@@H]1CCCc2ccccc21)Nc1ccccc1[C@H](O)C(F)(F)F |
| InChI | InChI=1S/C20H20F3NO2/c21-20(22,23)19(26)16-10-3-4-11-17(16)24-18(25)12-14-8-5-7-13-6-1-2-9-15(13)14/h1-4,6,9-11,14,19,26H,5,7-8,12H2,(H,24,25)/t14-,19-/m0/s1 |
| InChIKey | QLRKWNMXPURBMC-LIRRHRJNSA-N |
| XLogP | 4.73 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |