C17H28ClN3O3 — CID 119620715
N-[1-[2-(cycloheptylamino)ethylamino]-1-oxopropan-2-yl]furan-2-carboxamide;hydrochloride (PubChem CID 119620715) has the molecular formula C17H28ClN3O3 and a molecular weight of 357.88 g/mol. Its IUPAC name is N-[1-[2-(cycloheptylamino)ethylamino]-1-oxopropan-2-yl]furan-2-carboxamide;hydrochloride.
| Compound Name | N-[1-[2-(cycloheptylamino)ethylamino]-1-oxopropan-2-yl]furan-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119620715 |
| Molecular Formula | C17H28ClN3O3 |
| Molecular Weight | 357.88 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | N-[1-[2-(cycloheptylamino)ethylamino]-1-oxopropan-2-yl]furan-2-carboxamide;hydrochloride |
| SMILES | CC(NC(=O)c1ccco1)C(=O)NCCNC1CCCCCC1.Cl |
| InChI | InChI=1S/C17H27N3O3.ClH/c1-13(20-17(22)15-9-6-12-23-15)16(21)19-11-10-18-14-7-4-2-3-5-8-14;/h6,9,12-14,18H,2-5,7-8,10-11H2,1H3,(H,19,21)(H,20,22);1H |
| InChIKey | UHHSYESUBBRCIU-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.88 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|