C14H21ClIN3O — CID 119623972
[4-(cyclopropylmethylamino)piperidin-1-yl]-(4-iodo-1H-pyrrol-2-yl)methanone;hydrochloride (PubChem CID 119623972) has the molecular formula C14H21ClIN3O and a molecular weight of 409.70 g/mol. Its IUPAC name is [4-(cyclopropylmethylamino)piperidin-1-yl]-(4-iodo-1H-pyrrol-2-yl)methanone;hydrochloride.
| Compound Name | [4-(cyclopropylmethylamino)piperidin-1-yl]-(4-iodo-1H-pyrrol-2-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119623972 |
| Molecular Formula | C14H21ClIN3O |
| Molecular Weight | 409.70 g/mol |
| Exact Mass | 409.04 |
| IUPAC Name | [4-(cyclopropylmethylamino)piperidin-1-yl]-(4-iodo-1H-pyrrol-2-yl)methanone;hydrochloride |
| SMILES | Cl.O=C(c1cc(I)c[nH]1)N1CCC(NCC2CC2)CC1 |
| InChI | InChI=1S/C14H20IN3O.ClH/c15-11-7-13(17-9-11)14(19)18-5-3-12(4-6-18)16-8-10-1-2-10;/h7,9-10,12,16-17H,1-6,8H2;1H |
| InChIKey | SCRABEOVQWYDPT-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.70 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|