C10H11IN2O3 — CID 119353613
1-(4-iodo-1H-pyrrole-2-carbonyl)pyrrolidine-3-carboxylic acid (PubChem CID 119353613) has the molecular formula C10H11IN2O3 and a molecular weight of 334.11 g/mol. Its IUPAC name is 1-(4-iodo-1H-pyrrole-2-carbonyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 1-(4-iodo-1H-pyrrole-2-carbonyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 119353613 |
| Molecular Formula | C10H11IN2O3 |
| Molecular Weight | 334.11 g/mol |
| Exact Mass | 333.98 |
| IUPAC Name | 1-(4-iodo-1H-pyrrole-2-carbonyl)pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCN(C(=O)c2cc(I)c[nH]2)C1 |
| InChI | InChI=1S/C10H11IN2O3/c11-7-3-8(12-4-7)9(14)13-2-1-6(5-13)10(15)16/h3-4,6,12H,1-2,5H2,(H,15,16) |
| InChIKey | GSEQZKNBYDAEAH-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.11 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|