C19H30ClN3O2 — CID 119644009
N-(2-amino-2-ethylbutyl)-2-chloro-5-(3,3-dimethylbutanoylamino)benzamide (PubChem CID 119644009) has the molecular formula C19H30ClN3O2 and a molecular weight of 367.92 g/mol. Its IUPAC name is N-(2-amino-2-ethylbutyl)-2-chloro-5-(3,3-dimethylbutanoylamino)benzamide.
| Compound Name | N-(2-amino-2-ethylbutyl)-2-chloro-5-(3,3-dimethylbutanoylamino)benzamide |
|---|---|
| PubChem CID | 119644009 |
| Molecular Formula | C19H30ClN3O2 |
| Molecular Weight | 367.92 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | N-(2-amino-2-ethylbutyl)-2-chloro-5-(3,3-dimethylbutanoylamino)benzamide |
| SMILES | CCC(N)(CC)CNC(=O)c1cc(NC(=O)CC(C)(C)C)ccc1Cl |
| InChI | InChI=1S/C19H30ClN3O2/c1-6-19(21,7-2)12-22-17(25)14-10-13(8-9-15(14)20)23-16(24)11-18(3,4)5/h8-10H,6-7,11-12,21H2,1-5H3,(H,22,25)(H,23,24) |
| InChIKey | VOYLZHVIADNTKG-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.92 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |