C18H25ClN2O4 — CID 120534859
4-[[2-chloro-5-(3,3-dimethylbutanoylamino)benzoyl]amino]pentanoic acid (PubChem CID 120534859) has the molecular formula C18H25ClN2O4 and a molecular weight of 368.86 g/mol. Its IUPAC name is 4-[[2-chloro-5-(3,3-dimethylbutanoylamino)benzoyl]amino]pentanoic acid.
| Compound Name | 4-[[2-chloro-5-(3,3-dimethylbutanoylamino)benzoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 120534859 |
| Molecular Formula | C18H25ClN2O4 |
| Molecular Weight | 368.86 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 4-[[2-chloro-5-(3,3-dimethylbutanoylamino)benzoyl]amino]pentanoic acid |
| SMILES | CC(CCC(=O)O)NC(=O)c1cc(NC(=O)CC(C)(C)C)ccc1Cl |
| InChI | InChI=1S/C18H25ClN2O4/c1-11(5-8-16(23)24)20-17(25)13-9-12(6-7-14(13)19)21-15(22)10-18(2,3)4/h6-7,9,11H,5,8,10H2,1-4H3,(H,20,25)(H,21,22)(H,23,24) |
| InChIKey | IXEJQHJSDSEWOW-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.86 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |