About (4R)-3-acetyl-4-phenyl-1,3-oxazolidin-2-one
(4R)-3-acetyl-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 11964416) has the molecular formula C11H11NO3
and a molecular weight of 205.21 g/mol. Its IUPAC name is (4R)-3-acetyl-4-phenyl-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | (4R)-3-acetyl-4-phenyl-1,3-oxazolidin-2-one |
| PubChem CID | 11964416 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | (4R)-3-acetyl-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | CC(=O)N1C(=O)OC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C11H11NO3/c1-8(13)12-10(7-15-11(12)14)9-5-3-2-4-6-9/h2-6,10H,7H2,1H3/t10-/m0/s1 |
| InChIKey | XALZBROPIGPSAQ-JTQLQIEISA-N |
| XLogP | 1.73 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R)-3-acetyl-4-phenyl-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-3-acetyl-4-phenyl-1,3-oxazolidin-2-one?
The IUPAC name of (4R)-3-acetyl-4-phenyl-1,3-oxazolidin-2-one (CID 11964416) is (4R)-3-acetyl-4-phenyl-1,3-oxazolidin-2-one.
What is the SMILES notation for (4R)-3-acetyl-4-phenyl-1,3-oxazolidin-2-one?
The canonical SMILES for (4R)-3-acetyl-4-phenyl-1,3-oxazolidin-2-one is CC(=O)N1C(=O)OC[C@H]1c1ccccc1.
What is the InChIKey of (4R)-3-acetyl-4-phenyl-1,3-oxazolidin-2-one?
The InChIKey is XALZBROPIGPSAQ-JTQLQIEISA-N. The full InChI is InChI=1S/C11H11NO3/c1-8(13)12-10(7-15-11(12)14)9-5-3-2-4-6-9/h2-6,10H,7H2,1H3/t10-/m0/s1.
What are the key properties of (4R)-3-acetyl-4-phenyl-1,3-oxazolidin-2-one?
(4R)-3-acetyl-4-phenyl-1,3-oxazolidin-2-one has a molecular weight of 205.21 g/mol, XLogP of 1.73, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-3-acetyl-4-phenyl-1,3-oxazolidin-2-one is sourced from PubChem (CID 11964416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).