C17H20BrF3N2O — CID 11964888
[4-bromo-2-(trifluoromethyl)phenyl]-[2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methanone (PubChem CID 11964888) has the molecular formula C17H20BrF3N2O and a molecular weight of 405.26 g/mol. Its IUPAC name is [4-bromo-2-(trifluoromethyl)phenyl]-[2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methanone.
| Compound Name | [4-bromo-2-(trifluoromethyl)phenyl]-[2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 11964888 |
| Molecular Formula | C17H20BrF3N2O |
| Molecular Weight | 405.26 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | [4-bromo-2-(trifluoromethyl)phenyl]-[2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1ccc(Br)cc1C(F)(F)F)N1CCCC1CN1CCCC1 |
| InChI | InChI=1S/C17H20BrF3N2O/c18-12-5-6-14(15(10-12)17(19,20)21)16(24)23-9-3-4-13(23)11-22-7-1-2-8-22/h5-6,10,13H,1-4,7-9,11H2 |
| InChIKey | DJOPZQDRPLMYSM-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.26 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |