C17H22ClN3O2 — CID 119650725
1-[2-[2-(methylaminomethyl)pyrrolidin-1-yl]-2-oxoethyl]quinolin-4-one;hydrochloride (PubChem CID 119650725) has the molecular formula C17H22ClN3O2 and a molecular weight of 335.83 g/mol. Its IUPAC name is 1-[2-[2-(methylaminomethyl)pyrrolidin-1-yl]-2-oxoethyl]quinolin-4-one;hydrochloride.
| Compound Name | 1-[2-[2-(methylaminomethyl)pyrrolidin-1-yl]-2-oxoethyl]quinolin-4-one;hydrochloride |
|---|---|
| PubChem CID | 119650725 |
| Molecular Formula | C17H22ClN3O2 |
| Molecular Weight | 335.83 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 1-[2-[2-(methylaminomethyl)pyrrolidin-1-yl]-2-oxoethyl]quinolin-4-one;hydrochloride |
| SMILES | CNCC1CCCN1C(=O)Cn1ccc(=O)c2ccccc21.Cl |
| InChI | InChI=1S/C17H21N3O2.ClH/c1-18-11-13-5-4-9-20(13)17(22)12-19-10-8-16(21)14-6-2-3-7-15(14)19;/h2-3,6-8,10,13,18H,4-5,9,11-12H2,1H3;1H |
| InChIKey | TZFVNNHHFQPMOW-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.83 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |