C12H19BrN2O2 — CID 119659763
N-(3-amino-4-methylpentyl)-3-bromo-N-methylfuran-2-carboxamide (PubChem CID 119659763) has the molecular formula C12H19BrN2O2 and a molecular weight of 303.20 g/mol. Its IUPAC name is N-(3-amino-4-methylpentyl)-3-bromo-N-methylfuran-2-carboxamide.
| Compound Name | N-(3-amino-4-methylpentyl)-3-bromo-N-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 119659763 |
| Molecular Formula | C12H19BrN2O2 |
| Molecular Weight | 303.20 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | N-(3-amino-4-methylpentyl)-3-bromo-N-methylfuran-2-carboxamide |
| SMILES | CC(C)C(N)CCN(C)C(=O)c1occc1Br |
| InChI | InChI=1S/C12H19BrN2O2/c1-8(2)10(14)4-6-15(3)12(16)11-9(13)5-7-17-11/h5,7-8,10H,4,6,14H2,1-3H3 |
| InChIKey | IMJDBJBNJYOTNF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 59.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.20 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |