C17H29ClN4O2 — CID 119660112
N-(3-amino-4-methylpentyl)-3-(dimethylcarbamoylamino)-N-methylbenzamide;hydrochloride (PubChem CID 119660112) has the molecular formula C17H29ClN4O2 and a molecular weight of 356.90 g/mol. Its IUPAC name is N-(3-amino-4-methylpentyl)-3-(dimethylcarbamoylamino)-N-methylbenzamide;hydrochloride.
| Compound Name | N-(3-amino-4-methylpentyl)-3-(dimethylcarbamoylamino)-N-methylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119660112 |
| Molecular Formula | C17H29ClN4O2 |
| Molecular Weight | 356.90 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | N-(3-amino-4-methylpentyl)-3-(dimethylcarbamoylamino)-N-methylbenzamide;hydrochloride |
| SMILES | CC(C)C(N)CCN(C)C(=O)c1cccc(NC(=O)N(C)C)c1.Cl |
| InChI | InChI=1S/C17H28N4O2.ClH/c1-12(2)15(18)9-10-21(5)16(22)13-7-6-8-14(11-13)19-17(23)20(3)4;/h6-8,11-12,15H,9-10,18H2,1-5H3,(H,19,23);1H |
| InChIKey | QDBZZBNJZGDKHF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.90 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |