C17H25Cl2N3O3S — CID 119663090
1-[4-(3-aminopropoxy)piperidin-1-yl]-2-[2-(furan-3-yl)-1,3-thiazol-4-yl]ethanone;dihydrochloride (PubChem CID 119663090) has the molecular formula C17H25Cl2N3O3S and a molecular weight of 422.38 g/mol. Its IUPAC name is 1-[4-(3-aminopropoxy)piperidin-1-yl]-2-[2-(furan-3-yl)-1,3-thiazol-4-yl]ethanone;dihydrochloride.
| Compound Name | 1-[4-(3-aminopropoxy)piperidin-1-yl]-2-[2-(furan-3-yl)-1,3-thiazol-4-yl]ethanone;dihydrochloride |
|---|---|
| PubChem CID | 119663090 |
| Molecular Formula | C17H25Cl2N3O3S |
| Molecular Weight | 422.38 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | 1-[4-(3-aminopropoxy)piperidin-1-yl]-2-[2-(furan-3-yl)-1,3-thiazol-4-yl]ethanone;dihydrochloride |
| SMILES | Cl.Cl.NCCCOC1CCN(C(=O)Cc2csc(-c3ccoc3)n2)CC1 |
| InChI | InChI=1S/C17H23N3O3S.2ClH/c18-5-1-8-23-15-2-6-20(7-3-15)16(21)10-14-12-24-17(19-14)13-4-9-22-11-13;;/h4,9,11-12,15H,1-3,5-8,10,18H2;2*1H |
| InChIKey | NVJOPBMAJMLSFN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.38 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|