C16H29ClN4O2 — CID 119664151
[4-(3-aminopropoxy)piperidin-1-yl]-(5-tert-butyl-1H-pyrazol-3-yl)methanone;hydrochloride (PubChem CID 119664151) has the molecular formula C16H29ClN4O2 and a molecular weight of 344.89 g/mol. Its IUPAC name is [4-(3-aminopropoxy)piperidin-1-yl]-(5-tert-butyl-1H-pyrazol-3-yl)methanone;hydrochloride.
| Compound Name | [4-(3-aminopropoxy)piperidin-1-yl]-(5-tert-butyl-1H-pyrazol-3-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119664151 |
| Molecular Formula | C16H29ClN4O2 |
| Molecular Weight | 344.89 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | [4-(3-aminopropoxy)piperidin-1-yl]-(5-tert-butyl-1H-pyrazol-3-yl)methanone;hydrochloride |
| SMILES | CC(C)(C)c1cc(C(=O)N2CCC(OCCCN)CC2)n[nH]1.Cl |
| InChI | InChI=1S/C16H28N4O2.ClH/c1-16(2,3)14-11-13(18-19-14)15(21)20-8-5-12(6-9-20)22-10-4-7-17;/h11-12H,4-10,17H2,1-3H3,(H,18,19);1H |
| InChIKey | AFTZWPWNQPZJOG-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.89 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|