C15H23ClF2N2O3S — CID 119664700
[4-(3-aminopropoxy)piperidin-1-yl]-[3-(difluoromethoxy)-5-methylthiophen-2-yl]methanone;hydrochloride (PubChem CID 119664700) has the molecular formula C15H23ClF2N2O3S and a molecular weight of 384.88 g/mol. Its IUPAC name is [4-(3-aminopropoxy)piperidin-1-yl]-[3-(difluoromethoxy)-5-methylthiophen-2-yl]methanone;hydrochloride.
| Compound Name | [4-(3-aminopropoxy)piperidin-1-yl]-[3-(difluoromethoxy)-5-methylthiophen-2-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119664700 |
| Molecular Formula | C15H23ClF2N2O3S |
| Molecular Weight | 384.88 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | [4-(3-aminopropoxy)piperidin-1-yl]-[3-(difluoromethoxy)-5-methylthiophen-2-yl]methanone;hydrochloride |
| SMILES | Cc1cc(OC(F)F)c(C(=O)N2CCC(OCCCN)CC2)s1.Cl |
| InChI | InChI=1S/C15H22F2N2O3S.ClH/c1-10-9-12(22-15(16)17)13(23-10)14(20)19-6-3-11(4-7-19)21-8-2-5-18;/h9,11,15H,2-8,18H2,1H3;1H |
| InChIKey | UNNBVZUTQOPYNI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.88 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|