C11H20ClN3O4S — CID 119665591
N-(1-aminohexan-2-yl)-5-sulfamoylfuran-2-carboxamide;hydrochloride (PubChem CID 119665591) has the molecular formula C11H20ClN3O4S and a molecular weight of 325.82 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-5-sulfamoylfuran-2-carboxamide;hydrochloride.
| Compound Name | N-(1-aminohexan-2-yl)-5-sulfamoylfuran-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119665591 |
| Molecular Formula | C11H20ClN3O4S |
| Molecular Weight | 325.82 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | N-(1-aminohexan-2-yl)-5-sulfamoylfuran-2-carboxamide;hydrochloride |
| SMILES | CCCCC(CN)NC(=O)c1ccc(S(N)(=O)=O)o1.Cl |
| InChI | InChI=1S/C11H19N3O4S.ClH/c1-2-3-4-8(7-12)14-11(15)9-5-6-10(18-9)19(13,16)17;/h5-6,8H,2-4,7,12H2,1H3,(H,14,15)(H2,13,16,17);1H |
| InChIKey | OPAAUSWGHPNPPU-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 128.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.82 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |