C13H24ClN3O4S — CID 119667798
N-(1-aminohexan-2-yl)-5-(methanesulfonamidomethyl)furan-2-carboxamide;hydrochloride (PubChem CID 119667798) has the molecular formula C13H24ClN3O4S and a molecular weight of 353.87 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-5-(methanesulfonamidomethyl)furan-2-carboxamide;hydrochloride.
| Compound Name | N-(1-aminohexan-2-yl)-5-(methanesulfonamidomethyl)furan-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119667798 |
| Molecular Formula | C13H24ClN3O4S |
| Molecular Weight | 353.87 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | N-(1-aminohexan-2-yl)-5-(methanesulfonamidomethyl)furan-2-carboxamide;hydrochloride |
| SMILES | CCCCC(CN)NC(=O)c1ccc(CNS(C)(=O)=O)o1.Cl |
| InChI | InChI=1S/C13H23N3O4S.ClH/c1-3-4-5-10(8-14)16-13(17)12-7-6-11(20-12)9-15-21(2,18)19;/h6-7,10,15H,3-5,8-9,14H2,1-2H3,(H,16,17);1H |
| InChIKey | CPWUMUKKELETKC-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 114.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.87 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |