C16H26Cl2N4O — CID 119665891
N-(1-aminohexan-2-yl)-3-(benzimidazol-1-yl)propanamide;dihydrochloride (PubChem CID 119665891) has the molecular formula C16H26Cl2N4O and a molecular weight of 361.32 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-3-(benzimidazol-1-yl)propanamide;dihydrochloride.
| Compound Name | N-(1-aminohexan-2-yl)-3-(benzimidazol-1-yl)propanamide;dihydrochloride |
|---|---|
| PubChem CID | 119665891 |
| Molecular Formula | C16H26Cl2N4O |
| Molecular Weight | 361.32 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | N-(1-aminohexan-2-yl)-3-(benzimidazol-1-yl)propanamide;dihydrochloride |
| SMILES | CCCCC(CN)NC(=O)CCn1cnc2ccccc21.Cl.Cl |
| InChI | InChI=1S/C16H24N4O.2ClH/c1-2-3-6-13(11-17)19-16(21)9-10-20-12-18-14-7-4-5-8-15(14)20;;/h4-5,7-8,12-13H,2-3,6,9-11,17H2,1H3,(H,19,21);2*1H |
| InChIKey | IRLGHHWTIVZNJE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.32 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |