About CID 11966755
CID 11966755 (PubChem CID 11966755) has the molecular formula C28H28BClN6O2PRu
and a molecular weight of 658.88 g/mol.
Molecular Properties
| Compound Name | CID 11966755 |
| PubChem CID | 11966755 |
| Molecular Formula | C28H28BClN6O2PRu |
| Molecular Weight | 658.88 g/mol |
| Exact Mass | 659.08 |
| IUPAC Name | — |
| SMILES | C=C(/C=C\P(c1ccccc1)c1ccccc1)C(=O)OCC.Cl[Ru+].c1cnn([B-](n2cccn2)n2cccn2)c1 |
| InChI | InChI=1S/C19H19O2P.C9H9BN6.ClH.Ru/c1-3-21-19(20)16(2)14-15-22(17-10-6-4-7-11-17)18-12-8-5-9-13-18;1-4-11-14(7-1)10(15-8-2-5-12-15)16-9-3-6-13-16;;/h4-15H,2-3H2,1H3;1-9H;1H;/q;-1;;+2/p-1/b15-14-;;; |
| InChIKey | VLVUTMPIOOKXGE-VBPHADAZSA-M |
| XLogP | 4.64 |
| TPSA | 79.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 658.88 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze CID 11966755 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11966755?
The IUPAC name of CID 11966755 (CID 11966755) is not available.
What is the SMILES notation for CID 11966755?
The canonical SMILES for CID 11966755 is C=C(/C=C\P(c1ccccc1)c1ccccc1)C(=O)OCC.Cl[Ru+].c1cnn([B-](n2cccn2)n2cccn2)c1.
What is the InChIKey of CID 11966755?
The InChIKey is VLVUTMPIOOKXGE-VBPHADAZSA-M. The full InChI is InChI=1S/C19H19O2P.C9H9BN6.ClH.Ru/c1-3-21-19(20)16(2)14-15-22(17-10-6-4-7-11-17)18-12-8-5-9-13-18;1-4-11-14(7-1)10(15-8-2-5-12-15)16-9-3-6-13-16;;/h4-15H,2-3H2,1H3;1-9H;1H;/q;-1;;+2/p-1/b15-14-;;;.
What are the key properties of CID 11966755?
CID 11966755 has a molecular weight of 658.88 g/mol, XLogP of 4.64, 9 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11966755 is sourced from PubChem (CID 11966755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).