C22H6Cl12O2 — CID 11967033
[4-[(1S,4R)-1,4,5,6,7,7-hexachlorobicyclo[2.2.1]hepta-2,5-diene-2-carbonyl]phenyl]-[(1R,4S)-1,4,5,6,7,7-hexachloro-2-bicyclo[2.2.1]hepta-2,5-dienyl]methanone (PubChem CID 11967033) has the molecular formula C22H6Cl12O2 and a molecular weight of 727.72 g/mol. Its IUPAC name is [4-[(1S,4R)-1,4,5,6,7,7-hexachlorobicyclo[2.2.1]hepta-2,5-diene-2-carbonyl]phenyl]-[(1R,4S)-1,4,5,6,7,7-hexachloro-2-bicyclo[2.2.1]hepta-2,5-dienyl]methanone.
| Compound Name | [4-[(1S,4R)-1,4,5,6,7,7-hexachlorobicyclo[2.2.1]hepta-2,5-diene-2-carbonyl]phenyl]-[(1R,4S)-1,4,5,6,7,7-hexachloro-2-bicyclo[2.2.1]hepta-2,5-dienyl]methanone |
|---|---|
| PubChem CID | 11967033 |
| Molecular Formula | C22H6Cl12O2 |
| Molecular Weight | 727.72 g/mol |
| Exact Mass | 721.66 |
| IUPAC Name | [4-[(1S,4R)-1,4,5,6,7,7-hexachlorobicyclo[2.2.1]hepta-2,5-diene-2-carbonyl]phenyl]-[(1R,4S)-1,4,5,6,7,7-hexachloro-2-bicyclo[2.2.1]hepta-2,5-dienyl]methanone |
| SMILES | O=C(C1=C[C@@]2(Cl)C(Cl)=C(Cl)[C@]1(Cl)C2(Cl)Cl)c1ccc(C(=O)C2=C[C@]3(Cl)C(Cl)=C(Cl)[C@@]2(Cl)C3(Cl)Cl)cc1 |
| InChI | InChI=1S/C22H6Cl12O2/c23-13-15(25)19(29)9(5-17(13,27)21(19,31)32)11(35)7-1-2-8(4-3-7)12(36)10-6-18(28)14(24)16(26)20(10,30)22(18,33)34/h1-6H/t17-,18+,19+,20- |
| InChIKey | AKGYAUCGJFOCIK-JVSBHGNQSA-N |
| XLogP | 9.60 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.72 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|