C15H19ClN6O3 — CID 119670857
N-(2-methyl-5-nitrophenyl)-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride (PubChem CID 119670857) has the molecular formula C15H19ClN6O3 and a molecular weight of 366.81 g/mol. Its IUPAC name is N-(2-methyl-5-nitrophenyl)-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride.
| Compound Name | N-(2-methyl-5-nitrophenyl)-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119670857 |
| Molecular Formula | C15H19ClN6O3 |
| Molecular Weight | 366.81 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | N-(2-methyl-5-nitrophenyl)-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NC(=O)c1cn(C2CCNCC2)nn1.Cl |
| InChI | InChI=1S/C15H18N6O3.ClH/c1-10-2-3-12(21(23)24)8-13(10)17-15(22)14-9-20(19-18-14)11-4-6-16-7-5-11;/h2-3,8-9,11,16H,4-7H2,1H3,(H,17,22);1H |
| InChIKey | JHTOXIMYCMHCMY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 114.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.81 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|