C18H25ClN6O3 — CID 119778293
N-[4-(4-nitrophenyl)butyl]-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride (PubChem CID 119778293) has the molecular formula C18H25ClN6O3 and a molecular weight of 408.89 g/mol. Its IUPAC name is N-[4-(4-nitrophenyl)butyl]-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride.
| Compound Name | N-[4-(4-nitrophenyl)butyl]-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119778293 |
| Molecular Formula | C18H25ClN6O3 |
| Molecular Weight | 408.89 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | N-[4-(4-nitrophenyl)butyl]-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCCCCc1ccc([N+](=O)[O-])cc1)c1cn(C2CCNCC2)nn1 |
| InChI | InChI=1S/C18H24N6O3.ClH/c25-18(17-13-23(22-21-17)15-8-11-19-12-9-15)20-10-2-1-3-14-4-6-16(7-5-14)24(26)27;/h4-7,13,15,19H,1-3,8-12H2,(H,20,25);1H |
| InChIKey | CXMRUHZISFLKKD-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 114.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.89 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|