C16H20Cl2N6O3 — CID 119696278
N-[(2-chloro-5-nitrophenyl)methyl]-N-methyl-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride (PubChem CID 119696278) has the molecular formula C16H20Cl2N6O3 and a molecular weight of 415.28 g/mol. Its IUPAC name is N-[(2-chloro-5-nitrophenyl)methyl]-N-methyl-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride.
| Compound Name | N-[(2-chloro-5-nitrophenyl)methyl]-N-methyl-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119696278 |
| Molecular Formula | C16H20Cl2N6O3 |
| Molecular Weight | 415.28 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | N-[(2-chloro-5-nitrophenyl)methyl]-N-methyl-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
| SMILES | CN(Cc1cc([N+](=O)[O-])ccc1Cl)C(=O)c1cn(C2CCNCC2)nn1.Cl |
| InChI | InChI=1S/C16H19ClN6O3.ClH/c1-21(9-11-8-13(23(25)26)2-3-14(11)17)16(24)15-10-22(20-19-15)12-4-6-18-7-5-12;/h2-3,8,10,12,18H,4-7,9H2,1H3;1H |
| InChIKey | IOBUQRLOGYSXFJ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 106.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|