C16H19ClFN5O — CID 119778568
N-[(2-chloro-4-fluorophenyl)methyl]-N-methyl-1-piperidin-4-yltriazole-4-carboxamide (PubChem CID 119778568) has the molecular formula C16H19ClFN5O and a molecular weight of 351.81 g/mol. Its IUPAC name is N-[(2-chloro-4-fluorophenyl)methyl]-N-methyl-1-piperidin-4-yltriazole-4-carboxamide.
| Compound Name | N-[(2-chloro-4-fluorophenyl)methyl]-N-methyl-1-piperidin-4-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 119778568 |
| Molecular Formula | C16H19ClFN5O |
| Molecular Weight | 351.81 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | N-[(2-chloro-4-fluorophenyl)methyl]-N-methyl-1-piperidin-4-yltriazole-4-carboxamide |
| SMILES | CN(Cc1ccc(F)cc1Cl)C(=O)c1cn(C2CCNCC2)nn1 |
| InChI | InChI=1S/C16H19ClFN5O/c1-22(9-11-2-3-12(18)8-14(11)17)16(24)15-10-23(21-20-15)13-4-6-19-7-5-13/h2-3,8,10,13,19H,4-7,9H2,1H3 |
| InChIKey | LHWSAXYPZHWHEP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.81 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |