C14H14ClFN4O — CID 105396445
(2-chloro-5-fluorophenyl)-(1-piperidin-4-yltriazol-4-yl)methanone (PubChem CID 105396445) has the molecular formula C14H14ClFN4O and a molecular weight of 308.74 g/mol. Its IUPAC name is (2-chloro-5-fluorophenyl)-(1-piperidin-4-yltriazol-4-yl)methanone.
| Compound Name | (2-chloro-5-fluorophenyl)-(1-piperidin-4-yltriazol-4-yl)methanone |
|---|---|
| PubChem CID | 105396445 |
| Molecular Formula | C14H14ClFN4O |
| Molecular Weight | 308.74 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | (2-chloro-5-fluorophenyl)-(1-piperidin-4-yltriazol-4-yl)methanone |
| SMILES | O=C(c1cn(C2CCNCC2)nn1)c1cc(F)ccc1Cl |
| InChI | InChI=1S/C14H14ClFN4O/c15-12-2-1-9(16)7-11(12)14(21)13-8-20(19-18-13)10-3-5-17-6-4-10/h1-2,7-8,10,17H,3-6H2 |
| InChIKey | WYLVXYZQZYCRDM-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.74 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |