C54H72O4 — CID 11967177
(23Z)-3,9,15,33-tetratert-butyl-37,38-dimethoxy-19,28-dioxahexacyclo[15.12.7.17,11.131,35.05,29.013,18]octatriaconta-1,3,5(29),7,9,11(38),13(18),14,16,23,31,33,35(37)-tridecaene (PubChem CID 11967177) has the molecular formula C54H72O4 and a molecular weight of 785.17 g/mol. Its IUPAC name is (23Z)-3,9,15,33-tetratert-butyl-37,38-dimethoxy-19,28-dioxahexacyclo[15.12.7.17,11.131,35.05,29.013,18]octatriaconta-1,3,5(29),7,9,11(38),13(18),14,16,23,31,33,35(37)-tridecaene.
| Compound Name | (23Z)-3,9,15,33-tetratert-butyl-37,38-dimethoxy-19,28-dioxahexacyclo[15.12.7.17,11.131,35.05,29.013,18]octatriaconta-1,3,5(29),7,9,11(38),13(18),14,16,23,31,33,35(37)-tridecaene |
|---|---|
| PubChem CID | 11967177 |
| Molecular Formula | C54H72O4 |
| Molecular Weight | 785.17 g/mol |
| Exact Mass | 784.54 |
| IUPAC Name | (23Z)-3,9,15,33-tetratert-butyl-37,38-dimethoxy-19,28-dioxahexacyclo[15.12.7.17,11.131,35.05,29.013,18]octatriaconta-1,3,5(29),7,9,11(38),13(18),14,16,23,31,33,35(37)-tridecaene |
| SMILES | COc1c2cc(C(C)(C)C)cc1Cc1cc(C(C)(C)C)cc3c1OCCC/C=C\CCCOc1c(cc(C(C)(C)C)cc1Cc1cc(C(C)(C)C)cc(c1OC)C3)C2 |
| InChI | InChI=1S/C54H72O4/c1-51(2,3)43-27-35-23-39-31-45(53(7,8)9)33-41-25-37-29-44(52(4,5)6)30-38(48(37)56-14)26-42-34-46(54(10,11)12)32-40(24-36(28-43)47(35)55-13)50(42)58-22-20-18-16-15-17-19-21-57-49(39)41/h15-16,27-34H,17-26H2,1-14H3/b16-15- |
| InChIKey | IQDMENOEPCHTSC-NXVVXOECSA-N |
| XLogP | 13.46 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.17 |
| LogP ≤ 5 | 13.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|