C17H26ClN3O5S — CID 119671829
4-methoxy-N-(3-morpholin-4-ylsulfonylphenyl)piperidine-4-carboxamide;hydrochloride (PubChem CID 119671829) has the molecular formula C17H26ClN3O5S and a molecular weight of 419.93 g/mol. Its IUPAC name is 4-methoxy-N-(3-morpholin-4-ylsulfonylphenyl)piperidine-4-carboxamide;hydrochloride.
| Compound Name | 4-methoxy-N-(3-morpholin-4-ylsulfonylphenyl)piperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119671829 |
| Molecular Formula | C17H26ClN3O5S |
| Molecular Weight | 419.93 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 4-methoxy-N-(3-morpholin-4-ylsulfonylphenyl)piperidine-4-carboxamide;hydrochloride |
| SMILES | COC1(C(=O)Nc2cccc(S(=O)(=O)N3CCOCC3)c2)CCNCC1.Cl |
| InChI | InChI=1S/C17H25N3O5S.ClH/c1-24-17(5-7-18-8-6-17)16(21)19-14-3-2-4-15(13-14)26(22,23)20-9-11-25-12-10-20;/h2-4,13,18H,5-12H2,1H3,(H,19,21);1H |
| InChIKey | SXRRXAHZYFFUNZ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.93 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |