C17H21N7O — CID 119678510
N-(1-ethylbenzimidazol-2-yl)-1-piperidin-4-yltriazole-4-carboxamide (PubChem CID 119678510) has the molecular formula C17H21N7O and a molecular weight of 339.40 g/mol. Its IUPAC name is N-(1-ethylbenzimidazol-2-yl)-1-piperidin-4-yltriazole-4-carboxamide.
| Compound Name | N-(1-ethylbenzimidazol-2-yl)-1-piperidin-4-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 119678510 |
| Molecular Formula | C17H21N7O |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | N-(1-ethylbenzimidazol-2-yl)-1-piperidin-4-yltriazole-4-carboxamide |
| SMILES | CCn1c(NC(=O)c2cn(C3CCNCC3)nn2)nc2ccccc21 |
| InChI | InChI=1S/C17H21N7O/c1-2-23-15-6-4-3-5-13(15)19-17(23)20-16(25)14-11-24(22-21-14)12-7-9-18-10-8-12/h3-6,11-12,18H,2,7-10H2,1H3,(H,19,20,25) |
| InChIKey | TWDVIHYVIYJBPW-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 89.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |